EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O5 |
| Net Charge | 0 |
| Average Mass | 268.309 |
| Monoisotopic Mass | 268.13107 |
| SMILES | CCCCC[C@@H](O)Cc1cc(O)c(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C14H20O5/c1-2-3-4-5-10(15)6-9-7-11(16)13(14(18)19)12(17)8-9/h7-8,10,15-17H,2-6H2,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | FYQVGLHZARJMDM-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (32114035) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dihydroxy-4-[(2R)-2-hydroxyheptyl]benzoic acid (CHEBI:213766) has functional parent salicylic acid (CHEBI:16914) |
| 2,6-dihydroxy-4-[(2R)-2-hydroxyheptyl]benzoic acid (CHEBI:213766) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2,6-dihydroxy-4-[(2R)-2-hydroxyheptyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9055361 | ChemSpider |