EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3O |
| Net Charge | 0 |
| Average Mass | 141.174 |
| Monoisotopic Mass | 141.09021 |
| SMILES | N[C@H](CO)Cc1cncn1 |
| InChI | InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | ZQISRDCJNBUVMM-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (7042909) | ||
| - | PubMed (21988831) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (2405251) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of glycylpeptide N-tetradecanoyltransferase (EC 2.3.1.97). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-histidinol (CHEBI:16255) has role Escherichia coli metabolite (CHEBI:76971) |
| L-histidinol (CHEBI:16255) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-histidinol (CHEBI:16255) has role EC 2.3.1.97 (glycylpeptide N-tetradecanoyltransferase) inhibitor (CHEBI:78691) |
| L-histidinol (CHEBI:16255) has role human metabolite (CHEBI:77746) |
| L-histidinol (CHEBI:16255) is a histidinol (CHEBI:43321) |
| L-histidinol (CHEBI:16255) is conjugate base of L-histidinol(1+) (CHEBI:57699) |
| L-histidinol (CHEBI:16255) is enantiomer of D-histidinol (CHEBI:235517) |
| Incoming Relation(s) |
| L-histidinol phosphate (CHEBI:16996) has functional parent L-histidinol (CHEBI:16255) |
| L-histidinol(1+) (CHEBI:57699) is conjugate acid of L-histidinol (CHEBI:16255) |
| D-histidinol (CHEBI:235517) is enantiomer of L-histidinol (CHEBI:16255) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(1H-imidazol-4-yl)propan-1-ol |
| Synonyms | Source |
|---|---|
| 4-[(S)-2-amino-3-hydroxypropyl]imidazole | ChEBI |
| L-Histidinol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00007479 | KNApSAcK |
| C00860 | KEGG COMPOUND |
| DB03811 | DrugBank |
| HISTIDINOL | MetaCyc |
| HMDB0003431 | HMDB |
| HSO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81955 | Reaxys |
| CAS:4836-52-6 | ChemIDplus |
| CAS:4836-52-6 | KEGG COMPOUND |
| Citations |
|---|