EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O7 |
| Net Charge | 0 |
| Average Mass | 354.399 |
| Monoisotopic Mass | 354.16785 |
| SMILES | CC(=O)O[C@H]1CC[C@H](C)O[C@@]12OCC1=C(C[C@H](O)[C@@](C)(O)C1=O)[C@@H]2C |
| InChI | InChI=1S/C18H26O7/c1-9-5-6-15(24-11(3)19)18(25-9)10(2)12-7-14(20)17(4,22)16(21)13(12)8-23-18/h9-10,14-15,20,22H,5-8H2,1-4H3/t9-,10-,14-,15-,17+,18+/m0/s1 |
| InChIKey | MQRSLEFTXDRECM-LBEPYRKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium lividum (ncbitaxon:70099) | - | DOI (10.1177/1934578x1601100219) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sargabetaopenilline H (CHEBI:213023) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(3R,3'S,4S,6S,6'S,7R)-6,7-dihydroxy-4,6',7-trimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 60596956 | ChemSpider |