EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC[C@H](C)C(=O)C(=O)O |
| InChI | InChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | JVQYSWDUAOAHFM-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) is a 3-methyl-2-oxovaleric acid (CHEBI:35932) |
| (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) is conjugate acid of (S)-3-methyl-2-oxovalerate (CHEBI:35146) |
| (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) is enantiomer of (R)-3-methyl-2-oxovaleric acid (CHEBI:28379) |
| Incoming Relation(s) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) is conjugate base of (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) |
| (R)-3-methyl-2-oxovaleric acid (CHEBI:28379) is enantiomer of (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) |
| IUPAC Name |
|---|
| (3S)-3-methyl-2-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| (S)-3-methyl-2-oxovaleric acid | ChEBI |
| (3S)-3-Methyl-2-oxopentanoic acid | KEGG COMPOUND |
| (S)-3-Methyl-2-oxopentanoic acid | KEGG COMPOUND |
| (S)-2-oxo-3-methylpentanoic acid | ChEBI |
| (3S)-3-methyl-2-oxopentanoic acid | ChEBI |
| (3S)-2-oxo-3-methyl-n-valeric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00671 | KEGG COMPOUND |
| LMFA01020275 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1722136 | Beilstein |
| Citations |
|---|