EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CCC(C)C(=O)C(=O)O |
| InChI | InChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
| InChIKey | JVQYSWDUAOAHFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-oxovaleric acid (CHEBI:35932) has functional parent valeric acid (CHEBI:17418) |
| 3-methyl-2-oxovaleric acid (CHEBI:35932) has role human metabolite (CHEBI:77746) |
| 3-methyl-2-oxovaleric acid (CHEBI:35932) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-methyl-2-oxovaleric acid (CHEBI:35932) is a branched-chain keto acid (CHEBI:191197) |
| 3-methyl-2-oxovaleric acid (CHEBI:35932) is conjugate acid of 3-methyl-2-oxovalerate (CHEBI:28654) |
| Incoming Relation(s) |
| (R)-3-methyl-2-oxovaleric acid (CHEBI:28379) is a 3-methyl-2-oxovaleric acid (CHEBI:35932) |
| (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) is a 3-methyl-2-oxovaleric acid (CHEBI:35932) |
| 3-methyl-2-oxovalerate (CHEBI:28654) is conjugate base of 3-methyl-2-oxovaleric acid (CHEBI:35932) |
| IUPAC Name |
|---|
| 3-methyl-2-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| α-oxo-β-methyl-n-valeric acid | ChEBI |
| 2-oxokolavenic acid | ChEBI |
| α-keto-β-methyl-n-valeric acid | ChEBI |
| α-oxo-β-methylvaleric acid | ChEBI |
| 3-ethyl-3-methylpyruvic acid | ChemIDplus |
| alpha-keto-beta-methylvaleric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000491 | HMDB |
| C03465 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:971983 | Gmelin |
| Reaxys:1098987 | Reaxys |
| CAS:1460-34-0 | ChemIDplus |
| CAS:1460-34-0 | KEGG COMPOUND |
| Citations |
|---|