EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O3 |
| Net Charge | -1 |
| Average Mass | 129.135 |
| Monoisotopic Mass | 129.05572 |
| SMILES | CC[C@H](C)C(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | JVQYSWDUAOAHFM-BYPYZUCNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) has functional parent valerate (CHEBI:31011) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) is a 3-methyl-2-oxovalerate (CHEBI:28654) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) is conjugate base of (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) |
| (S)-3-methyl-2-oxovalerate (CHEBI:35146) is enantiomer of (R)-3-methyl-2-oxovalerate (CHEBI:228255) |
| Incoming Relation(s) |
| (S)-3-methyl-2-oxovaleric acid (CHEBI:15614) is conjugate acid of (S)-3-methyl-2-oxovalerate (CHEBI:35146) |
| (R)-3-methyl-2-oxovalerate (CHEBI:228255) is enantiomer of (S)-3-methyl-2-oxovalerate (CHEBI:35146) |
| IUPAC Name |
|---|
| (3S)-3-methyl-2-oxopentanoate |
| Synonyms | Source |
|---|---|
| (3S)-3-Methyl-2-oxopentanoate | KEGG COMPOUND |
| (S)-3-methyl-2-oxopentanoate | ChEBI |
| (S)-3-methyl-2-oxovalerate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-3-methyl-2-oxopentanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00671 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3904283 | Beilstein |