EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37012 - L-3-oxoalanine
| Formula | C3H5NO3 |
| Net Charge | 0 |
| Average Mass | 103.077 |
| Monoisotopic Mass | 103.02694 |
| SMILES | [H]C(=O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C3H5NO3/c4-2(1-5)3(6)7/h1-2H,4H2,(H,6,7)/t2-/m0/s1 |
| InChIKey | XMTCKNXTTXDPJX-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-3-oxoalanine (CHEBI:37012) has functional parent L-serine (CHEBI:17115) |
| L-3-oxoalanine (CHEBI:37012) has role Escherichia coli metabolite (CHEBI:76971) |
| L-3-oxoalanine (CHEBI:37012) is a L-alanine derivative (CHEBI:83943) |
| L-3-oxoalanine (CHEBI:37012) is a 3-oxoalanine (CHEBI:17740) |
| L-3-oxoalanine (CHEBI:37012) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-3-oxoalanine (CHEBI:37012) is conjugate acid of L-3-oxoalaninate (CHEBI:58671) |
| L-3-oxoalanine (CHEBI:37012) is tautomer of L-3-oxoalanine zwitterion (CHEBI:77662) |
| Incoming Relation(s) |
| L-3-oxoalaninate (CHEBI:58671) is conjugate base of L-3-oxoalanine (CHEBI:37012) |
| L-3-oxoalanine residue (CHEBI:85621) is substituent group from L-3-oxoalanine (CHEBI:37012) |
| L-3-oxoalanine zwitterion (CHEBI:77662) is tautomer of L-3-oxoalanine (CHEBI:37012) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-oxopropanoic acid |
| 3-oxo-L-alanine |
| Synonyms | Source |
|---|---|
| 2-Aminomalonate semialdehyde | KEGG COMPOUND |
| 2-Ammoniomalonate semialdehyde | KEGG COMPOUND |
| L-α-formylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11822 | KEGG COMPOUND |