EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4NO3 |
| Net Charge | -1 |
| Average Mass | 102.069 |
| Monoisotopic Mass | 102.01967 |
| SMILES | [H]C(=O)[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C3H5NO3/c4-2(1-5)3(6)7/h1-2H,4H2,(H,6,7)/p-1/t2-/m0/s1 |
| InChIKey | XMTCKNXTTXDPJX-REOHCLBHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-3-oxoalaninate (CHEBI:58671) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-3-oxoalaninate (CHEBI:58671) is a L-α-amino acid anion (CHEBI:59814) |
| L-3-oxoalaninate (CHEBI:58671) is a 3-oxo monocarboxylic acid anion (CHEBI:35973) |
| L-3-oxoalaninate (CHEBI:58671) is conjugate base of L-3-oxoalanine (CHEBI:37012) |
| Incoming Relation(s) |
| L-3-oxoalanine (CHEBI:37012) is conjugate acid of L-3-oxoalaninate (CHEBI:58671) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-oxopropanoate |
| 3-oxo-L-alaninate |
| Synonym | Source |
|---|---|
| L-α-formylglycinate | ChEBI |