EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17924 - D-glucitol
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2122h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | FBPFZTCFMRRESA-JGWLITMVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | sweetening agent Substance that sweeten food, beverages, medications, etc. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucitol (CHEBI:17924) has role Escherichia coli metabolite (CHEBI:76971) |
| D-glucitol (CHEBI:17924) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-glucitol (CHEBI:17924) has role cathartic (CHEBI:75325) |
| D-glucitol (CHEBI:17924) has role food humectant (CHEBI:77969) |
| D-glucitol (CHEBI:17924) has role human metabolite (CHEBI:77746) |
| D-glucitol (CHEBI:17924) has role laxative (CHEBI:50503) |
| D-glucitol (CHEBI:17924) has role metabolite (CHEBI:25212) |
| D-glucitol (CHEBI:17924) has role mouse metabolite (CHEBI:75771) |
| D-glucitol (CHEBI:17924) has role sweetening agent (CHEBI:50505) |
| D-glucitol (CHEBI:17924) is a glucitol (CHEBI:30911) |
| D-glucitol (CHEBI:17924) is enantiomer of L-glucitol (CHEBI:28789) |
| Incoming Relation(s) |
| D-glucitol 3-phosphate (CHEBI:21092) has functional parent D-glucitol (CHEBI:17924) |
| D-glucitol 6-phosphate (CHEBI:17044) has functional parent D-glucitol (CHEBI:17924) |
| 1,5-anhydro-D-glucitol (CHEBI:16070) has functional parent D-glucitol (CHEBI:17924) |
| 6-O-α-D-glucopyranosyl-D-glucitol (CHEBI:152898) has functional parent D-glucitol (CHEBI:17924) |
| cellobiotol (CHEBI:152395) has functional parent D-glucitol (CHEBI:17924) |
| gentiobiitol (CHEBI:150274) has functional parent D-glucitol (CHEBI:17924) |
| maltitol (CHEBI:68428) has functional parent D-glucitol (CHEBI:17924) |
| α-D-Galp-(1→6)-D-Glc-OH (CHEBI:153263) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-D-Glc-OH (CHEBI:151453) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→3)-D-Glc-OH (CHEBI:148578) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→4)-D-Glu-OH (CHEBI:152991) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→3)-[β-D-Galp-(1→4)]-D-Glc-ol (CHEBI:146034) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→4)-[β-D-Galp-(1→3)]-β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-D-Glc-ol (CHEBI:62529) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Rhap-(1→2)-[α-L-Rhap-(1→2)-α-D-Galp-(1→3)-β-D-GlcpNAc-(1→4)]-α-L-Rhap-(1→2)-α-L-Rhap-(1→1')-[α-L-Rhap-(1→3')]-D-glucitol (CHEBI:62489) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Rhap-(1→3)-D-glucitol (CHEBI:61784) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Gal-(1→3)-β-D-GlcNAc-(1→3)-[β-D-GlcNAc-(1→6)]-β-D-Gal-(1→4)-D-Glc-ol (CHEBI:62661) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Galp-(1→3)-[α-L-Fucp-(1→4)]-β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-[α-L-Fucp-(1→3)]-D-Glc-ol (CHEBI:62525) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Glcp-(1→2)-D-Glc-OH (CHEBI:153954) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Glcp-(1→3)-D-Glc-OH (CHEBI:154588) has functional parent D-glucitol (CHEBI:17924) |
| β-D-GlcNAc-(1→3)-[β-D-GlcNAc-(1→6)]-β-D-Gal-(1→4)-D-Glc-ol (CHEBI:62660) has functional parent D-glucitol (CHEBI:17924) |
| D-sorbitol-13C6 (CHEBI:138264) is a D-glucitol (CHEBI:17924) |
| L-glucitol (CHEBI:28789) is enantiomer of D-glucitol (CHEBI:17924) |
| IUPAC Name |
|---|
| D-glucitol |
| Synonyms | Source |
|---|---|
| (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol | IUPAC |
| D-Glucitol | KEGG COMPOUND |
| D-Sorbitol | KEGG COMPOUND |
| D-SORBITOL | PDBeChem |
| E 420 | ChEBI |
| E-420 | ChEBI |
| UniProt Name | Source |
|---|---|
| D-sorbitol | UniProt |
| Citations |
|---|