EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68428 - maltitol
| Formula | C12H24O11 |
| Net Charge | 0 |
| Average Mass | 344.313 |
| Monoisotopic Mass | 344.13186 |
| SMILES | OC[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/2,2,1/[h2122h][a2122h-1a_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+/m0/s1 |
| InChIKey | VQHSOMBJVWLPSR-WUJBLJFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Applications: | sweetening agent Substance that sweeten food, beverages, medications, etc. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maltitol (CHEBI:68428) has functional parent D-glucitol (CHEBI:17924) |
| maltitol (CHEBI:68428) has functional parent α-D-glucose (CHEBI:17925) |
| maltitol (CHEBI:68428) has role laxative (CHEBI:50503) |
| maltitol (CHEBI:68428) has role metabolite (CHEBI:25212) |
| maltitol (CHEBI:68428) has role sweetening agent (CHEBI:50505) |
| maltitol (CHEBI:68428) is a glycosyl alditol (CHEBI:36307) |
| maltitol (CHEBI:68428) is a α-D-glucoside (CHEBI:22390) |
| IUPAC Name |
|---|
| α-D-glucopyranosyl-(1→4)-D-glucitol |
| Synonyms | Source |
|---|---|
| (2S,3R,4R,5R)-4-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}hexane-1,2,3,5,6-pentol | IUPAC |
| 4-O-α-D-glucopyranosyl-D-glucitol | IUPAC |
| D-Maltitol | ChemIDplus |
| α-D-glucosyl-(1→4)-D-glucitol | ChEBI |
| α-D-Glcp-(1→4)-D-Glc-ol | ChEBI |
| α-D-Glc-(1→4)-D-Glc-ol | ChEBI |
| Citations |
|---|