EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | CC1=CC2=CC(=O)[C@@](C)(O)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C11H14O4/c1-6-3-7-4-9(12)11(2,14)10(13)8(7)5-15-6/h3-4,8,10,13-14H,5H2,1-2H3/t8-,10+,11-/m1/s1 |
| InChIKey | OFLQNOVREAGOBE-DVVUODLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nemania (ncbitaxon:109374) | - | DOI (10.1016/j.tet.2017.05.030) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nemanecin A (CHEBI:210796) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S,8S,8aS)-7,8-dihydroxy-3,7-dimethyl-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78439166 | ChemSpider |