EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32ClNO6 |
| Net Charge | 0 |
| Average Mass | 489.996 |
| Monoisotopic Mass | 489.19182 |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(OC(C)=O)C(=O)C2=CN1CCCC(=O)OC |
| InChI | InChI=1S/C26H32ClNO6/c1-7-16(2)13-17(3)10-11-19-14-20-21(15-28(19)12-8-9-22(30)33-6)24(31)26(5,34-18(4)29)25(32)23(20)27/h10-11,13-16H,7-9,12H2,1-6H3/b11-10+,17-13+/t16-,26+/m0/s1 |
| InChIKey | XWWNMYFZBOZWKF-ZGLDCBQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31077912) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sclerketide C (CHEBI:210580) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| methyl 4-[(7R)-7-acetyloxy-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisoquinolin-2-yl]butanoate |
| Manual Xrefs | Databases |
|---|---|
| 74122705 | ChemSpider |