EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16659 - D-glycerate
| Formula | C3H5O4 |
| Net Charge | -1 |
| Average Mass | 105.069 |
| Monoisotopic Mass | 105.01933 |
| SMILES | O=C([O-])[C@H](O)CO |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/p-1/t2-/m1/s1 |
| InChIKey | RBNPOMFGQQGHHO-UWTATZPHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glycerate (CHEBI:16659) has role algal metabolite (CHEBI:84735) |
| D-glycerate (CHEBI:16659) is a glycerate (CHEBI:33871) |
| D-glycerate (CHEBI:16659) is conjugate base of D-glyceric acid (CHEBI:32398) |
| Incoming Relation(s) |
| D-glyceric acid (CHEBI:32398) is conjugate acid of D-glycerate (CHEBI:16659) |
| IUPAC Name |
|---|
| (2R)-2,3-dihydroxypropanoate |
| Synonyms | Source |
|---|---|
| (R)-glycerate anion | ChEBI |
| (R)-glycerate | HMDB |
| α,β-Hydroxypropionate | HMDB |
| UniProt Name | Source |
|---|---|
| (R)-glycerate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00258 | KEGG COMPOUND |
| HMDB0000139 | HMDB |
| GLYCERATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1146853 | Gmelin |
| Reaxys:6114954 | Reaxys |