EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23BrO7 |
| Net Charge | 0 |
| Average Mass | 479.323 |
| Monoisotopic Mass | 478.06272 |
| SMILES | CC=CC1=CC2=CC(=O)[C@](C)(OC(=O)c3c(OC)cc(O)c(Br)c3C)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C22H23BrO7/c1-5-6-13-7-12-8-17(25)22(3,20(26)14(12)10-29-13)30-21(27)18-11(2)19(23)15(24)9-16(18)28-4/h5-9,14,20,24,26H,10H2,1-4H3/t14-,20+,22+/m1/s1 |
| InChIKey | NCSVIJIOZBZEKQ-XDCJIHQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus falconensis (ncbitaxon:1810910) | - | PubMed (32290208) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Falconensin Q (CHEBI:209970) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7R,8S,8aS)-8-hydroxy-7-methyl-6-oxo-3-prop-1-enyl-8,8a-dihydro-1H-isochromen-7-yl] 3-bromo-4-hydroxy-6-methoxy-2-methylbenzoate |