EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O6 |
| Net Charge | 0 |
| Average Mass | 298.335 |
| Monoisotopic Mass | 298.14164 |
| SMILES | C[C@H]1C[C@H](O)C[C@@]2(CC3=C(CO2)C(=O)[C@](C)(O)[C@H](O)C3)O1 |
| InChI | InChI=1S/C15H22O6/c1-8-3-10(16)6-15(21-8)5-9-4-12(17)14(2,19)13(18)11(9)7-20-15/h8,10,12,16-17,19H,3-7H2,1-2H3/t8-,10-,12+,14+,15+/m0/s1 |
| InChIKey | WSMRVKVOISZOIC-JIMHZFRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (25501795) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sargabetaopenilline E (CHEBI:209964) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (3R,4'S,6R,6'S,7R)-4',6,7-trihydroxy-6',7-dimethylspiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-8-one |
| Manual Xrefs | Databases |
|---|---|
| 34981872 | ChemSpider |