EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | CC[C@]1(C)C(=O)C=C2C(C)=C(C)OCC2(O)C1=O |
| InChI | InChI=1S/C14H18O4/c1-5-13(4)11(15)6-10-8(2)9(3)18-7-14(10,17)12(13)16/h6,17H,5,7H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | OSDXJRGNMMQGPL-KWCCSABGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyrenochaeta nobilis (ncbitaxon:390895) | - | PubMed (31979232) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8a-hydroxy-spiciferinone (CHEBI:209694) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R)-7-ethyl-8a-hydroxy-3,4,7-trimethyl-1H-isochromene-6,8-dione |
| Manual Xrefs | Databases |
|---|---|
| 81369103 | ChemSpider |