EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O3 |
| Net Charge | 0 |
| Average Mass | 234.295 |
| Monoisotopic Mass | 234.12559 |
| SMILES | CC[C@]1(C)C(=O)C=C2C(=COC(C)=C2C)[C@@H]1O |
| InChI | InChI=1S/C14H18O3/c1-5-14(4)12(15)6-10-8(2)9(3)17-7-11(10)13(14)16/h6-7,13,16H,5H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | LKLDCIAUKWMSCO-UONOGXRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptosphaeriaspecies (ncbitaxon:1755431) | - | DOI (10.1002/1522-2675(200209)85:9<2664::AID-HLCA2664>3.0.CO;2-R) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leptosphaerone (CHEBI:209572) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S,8S)-7-ethyl-8-hydroxy-3,4,7-trimethyl-8H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78443567 | ChemSpider |