EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16NO8P |
| Net Charge | -2 |
| Average Mass | 297.200 |
| Monoisotopic Mass | 297.06245 |
| SMILES | CC(C)(COP(=O)([O-])O)[C@@H](O)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H18NO8P/c1-9(2,5-18-19(15,16)17)7(13)8(14)10-4-3-6(11)12/h7,13H,3-5H2,1-2H3,(H,10,14)(H,11,12)(H2,15,16,17)/p-2/t7-/m0/s1 |
| InChIKey | XHFVGHPGDLDEQO-ZETCQYMHSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4'-phosphopantothenate(2−) (CHEBI:20891) has functional parent (R)-pantothenic acid (CHEBI:46905) |
| (R)-4'-phosphopantothenate(2−) (CHEBI:20891) is a amidoalkyl phosphate (CHEBI:37481) |
| (R)-4'-phosphopantothenate(2−) (CHEBI:20891) is conjugate acid of (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) |
| (R)-4'-phosphopantothenate(2−) (CHEBI:20891) is conjugate base of (R)-4'-phosphopantothenate(1−) (CHEBI:12886) |
| Incoming Relation(s) |
| (R)-4'-phosphopantothenate(1−) (CHEBI:12886) is conjugate acid of (R)-4'-phosphopantothenate(2−) (CHEBI:20891) |
| (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) is conjugate base of (R)-4'-phosphopantothenate(2−) (CHEBI:20891) |
| IUPAC Name |
|---|
| 3-[(2R)-2-hydroxy-4-[(hydroxyphosphinato)oxy]-3,3-dimethylbutanamido]propanoate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9284851 | Beilstein |