EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO8P |
| Net Charge | -3 |
| Average Mass | 296.192 |
| Monoisotopic Mass | 296.05517 |
| SMILES | CC(C)(COP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H18NO8P/c1-9(2,5-18-19(15,16)17)7(13)8(14)10-4-3-6(11)12/h7,13H,3-5H2,1-2H3,(H,10,14)(H,11,12)(H2,15,16,17)/p-3/t7-/m0/s1 |
| InChIKey | XHFVGHPGDLDEQO-ZETCQYMHSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) has functional parent (R)-pantothenic acid (CHEBI:46905) |
| (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) has role human metabolite (CHEBI:77746) |
| (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) is a organophosphate oxoanion (CHEBI:58945) |
| (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) is conjugate base of (R)-4'-phosphopantothenate(2−) (CHEBI:20891) |
| Incoming Relation(s) |
| (R)-4'-phosphopantothenate(2−) (CHEBI:20891) is conjugate acid of (R)-4'-phosphonatopantothenate(3−) (CHEBI:10986) |
| IUPAC Name |
|---|
| 3-[(2R)-2-hydroxy-3,3-dimethyl-4-(phosphonatooxy)butanamido]propanoate |
| UniProt Name | Source |
|---|---|
| (R)-4'-phosphopantothenate | UniProt |