EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15ClO5 |
| Net Charge | 0 |
| Average Mass | 298.722 |
| Monoisotopic Mass | 298.06080 |
| SMILES | CC(=O)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(O)[C@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C14H15ClO5/c1-7(16)3-4-8-5-9-10(6-20-8)12(17)14(2,19)13(18)11(9)15/h3-5,10,12,17,19H,6H2,1-2H3/b4-3+/t10-,12-,14-/m1/s1 |
| InChIKey | UJVLDBPBZYHNOB-ZMAPLJKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sclerotiorum (ncbitaxon:69788) | - | DOI (10.1039/c7ra13327h) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicilazaphilone D (CHEBI:208539) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8R,8aS)-5-chloro-7,8-dihydroxy-7-methyl-3-[(E)-3-oxobut-1-enyl]-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 64808957 | ChemSpider |