EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H54Cl2N2O8 |
| Net Charge | 0 |
| Average Mass | 833.850 |
| Monoisotopic Mass | 832.32572 |
| SMILES | CC[C@H](C)C=C(C)C=CC1=CC2=C(Cl)C(=O)[C@](C)(OC(C)=O)C(=O)C2=CN1CCCCN1C=C2C(=O)[C@@](C)(OC(C)=O)C(=O)C(Cl)=C2C=C1C=CC(C)=C[C@@H](C)CC |
| InChI | InChI=1S/C46H54Cl2N2O8/c1-11-27(3)21-29(5)15-17-33-23-35-37(41(53)45(9,57-31(7)51)43(55)39(35)47)25-49(33)19-13-14-20-50-26-38-36(24-34(50)18-16-30(6)22-28(4)12-2)40(48)44(56)46(10,42(38)54)58-32(8)52/h15-18,21-28H,11-14,19-20H2,1-10H3/t27-,28-,45+,46+/m0/s1 |
| InChIKey | GXUYGLKNAQMTRM-UBERKXOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31052279) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sclerotiorin E (CHEBI:208169) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7R)-2-[4-[(7R)-7-acetyloxy-5-chloro-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisoquinolin-2-yl]butyl]-5-chloro-3-[(5S)-3,5-dimethylhepta-1,3-dienyl]-7-methyl-6,8-dioxoisoquinolin-7-yl] acetate |