EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=C(O)c1ccc(O)nc1 |
| InChI | InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | BLHCMGRVFXRYRN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | PubMed (10952545) | |
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (21389975) | ||
| - | MetaboLights (MTBLS20) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxynicotinic acid (CHEBI:16168) has functional parent nicotinic acid (CHEBI:15940) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role human urinary metabolite (CHEBI:84087) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role mouse metabolite (CHEBI:75771) |
| 6-hydroxynicotinic acid (CHEBI:16168) is a monohydroxypyridine (CHEBI:38182) |
| 6-hydroxynicotinic acid (CHEBI:16168) is conjugate acid of 6-hydroxynicotinate(1−) (CHEBI:57664) |
| Incoming Relation(s) |
| 6-hydroxynicotinate(1−) (CHEBI:57664) is conjugate base of 6-hydroxynicotinic acid (CHEBI:16168) |
| IUPAC Name |
|---|
| 6-hydroxypyridine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-Hydroxynicotinate | KEGG COMPOUND |
| 6-Hydroxynicotinic acid | KEGG COMPOUND |
| Citations |
|---|