EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O5 |
| Net Charge | 0 |
| Average Mass | 334.412 |
| Monoisotopic Mass | 334.17802 |
| SMILES | CC(/C=C/C1=CC2=CC(=O)[C@](C)(O)[C@H](O)[C@H]2CO1)=C\C(C)CCO |
| InChI | InChI=1S/C19H26O5/c1-12(8-13(2)6-7-20)4-5-15-9-14-10-17(21)19(3,23)18(22)16(14)11-24-15/h4-5,8-10,13,16,18,20,22-23H,6-7,11H2,1-3H3/b5-4+,12-8+/t13?,16-,18+,19-/m0/s1 |
| InChIKey | KVAHSFRJCBQVAW-WANGHWJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.3987/COM-19-14164) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isochromophilol A (CHEBI:207263) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8R,8aR)-7,8-dihydroxy-3-[(1E,3E)-7-hydroxy-3,5-dimethylhepta-1,3-dienyl]-7-methyl-8,8a-dihydro-1H-isochromen-6-one |