EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28ClNO6 |
| Net Charge | 0 |
| Average Mass | 449.931 |
| Monoisotopic Mass | 449.16052 |
| SMILES | CC(=O)O[C@@]1(C)C(=O)C2=CN(CCO)C(C=CC(C)=C[C@@H](C)[C@@H](C)O)=CC2=C(Cl)C1=O |
| InChI | InChI=1S/C23H28ClNO6/c1-13(10-14(2)15(3)27)6-7-17-11-18-19(12-25(17)8-9-26)21(29)23(5,31-16(4)28)22(30)20(18)24/h6-7,10-12,14-15,26-27H,8-9H2,1-5H3/t14-,15-,23+/m1/s1 |
| InChIKey | DEJPZRICRUJCQX-WBPRFABPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (30702881) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penazaphilone C (CHEBI:207177) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7S)-5-chloro-3-[(5R,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-2-(2-hydroxyethyl)-7-methyl-6,8-dioxoisoquinolin-7-yl] acetate |