EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O8 |
| Net Charge | 0 |
| Average Mass | 356.371 |
| Monoisotopic Mass | 356.14712 |
| SMILES | CC(=O)O[C@H]1CC[C@H](C)O[C@@]12OCC1=C(C[C@@H](O)[C@@](C)(O)C1=O)C2O |
| InChI | InChI=1S/C17H24O8/c1-8-4-5-13(24-9(2)18)17(25-8)15(21)10-6-12(19)16(3,22)14(20)11(10)7-23-17/h8,12-13,15,19,21-22H,4-7H2,1-3H3/t8-,12+,13-,15?,16+,17-/m0/s1 |
| InChIKey | ULIAZBXBSMSWPV-PKFCVDLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (25501795) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sargabetaopenilline F (CHEBI:207089) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(3R,3'S,6R,6'S,7R)-4,6,7-trihydroxy-6',7-dimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 34981952 | ChemSpider |