EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O4 |
| Net Charge | 0 |
| Average Mass | 212.245 |
| Monoisotopic Mass | 212.10486 |
| SMILES | C[C@@H]1CC2=C(CO1)C(=O)[C@](C)(O)[C@@H](O)C2 |
| InChI | InChI=1S/C11H16O4/c1-6-3-7-4-9(12)11(2,14)10(13)8(7)5-15-6/h6,9,12,14H,3-5H2,1-2H3/t6-,9+,11-/m1/s1 |
| InChIKey | WUTMPUKLLJPVCV-OUAIYISWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | DOI (10.1002/hlca.201500048) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hypoillexidiol (CHEBI:207087) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (3R,6S,7R)-6,7-dihydroxy-3,7-dimethyl-3,4,5,6-tetrahydro-1H-isochromen-8-one |
| Manual Xrefs | Databases |
|---|---|
| 58196417 | ChemSpider |