EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | COc1cc(/C=C/C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+ |
| InChIKey | YFXWTVLDSKSYLW-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-5-hydroxyferulic acid (CHEBI:2069) is a 5-hydroxyferulic acid (CHEBI:20582) |
| (E)-5-hydroxyferulic acid (CHEBI:2069) is conjugate acid of (E)-5-hydroxyferulate (CHEBI:144381) |
| Incoming Relation(s) |
| N1,N5,N10-tri-((E)-5-hydroxyferuloyl)-spermidine (CHEBI:232335) has functional parent (E)-5-hydroxyferulic acid (CHEBI:2069) |
| (E)-5-hydroxyferulate (CHEBI:144381) is conjugate base of (E)-5-hydroxyferulic acid (CHEBI:2069) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid | KEGG COMPOUND |
| 3-methoxy-4,5-dihydroxy-trans-cinnamic acid | ChEBI |
| (E)-5-hydroxyferulic acid | ChEBI |
| trans-5-hydroxyferulic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035484 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:110642-42-7 | ChEBI |