EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | [H]C(=Cc1cc(O)c(O)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13) |
| InChIKey | YFXWTVLDSKSYLW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyferulic acid (CHEBI:20582) is a hydroxycinnamic acid (CHEBI:24689) |
| 5-hydroxyferulic acid (CHEBI:20582) is a methoxycinnamic acid (CHEBI:61407) |
| 5-hydroxyferulic acid (CHEBI:20582) is conjugate acid of 5-hydroxyferulate (CHEBI:144056) |
| Incoming Relation(s) |
| N1,N5,N10-tri-(5-hydroxyferuloyl)-spermidine (CHEBI:81480) has functional parent 5-hydroxyferulic acid (CHEBI:20582) |
| 5-hydroxyferuloyl-CoA (CHEBI:31136) has functional parent 5-hydroxyferulic acid (CHEBI:20582) |
| (E)-5-hydroxyferulic acid (CHEBI:2069) is a 5-hydroxyferulic acid (CHEBI:20582) |
| 5-hydroxyferulate (CHEBI:144056) is conjugate base of 5-hydroxyferulic acid (CHEBI:20582) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid | ChEBI |
| 3-(3,4-dihydroxy-5-methoxyphenyl)acrylic acid | ChEBI |
| 3,4-dihydroxy-5-methoxycinnamic acid | ChEBI |
| 3-methoxycaffeic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5-Hydroxyferulic_acid | Wikipedia |
| C00007336 | KNApSAcK |
| FDB014170 | FooDB |
| HMDB0035484 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2697317 | Beilstein |
| CAS:1782-55-4 | ChemIDplus |
| Citations |
|---|