EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O5 |
| Net Charge | 0 |
| Average Mass | 252.226 |
| Monoisotopic Mass | 252.07462 |
| SMILES | [H]C(=O)Nc1ccc(O)cc1C(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C11H12N2O5/c12-8(11(17)18)4-10(16)7-3-6(15)1-2-9(7)13-5-14/h1-3,5,8,15H,4,12H2,(H,13,14)(H,17,18) |
| InChIKey | LSTOUSIIVKMJBU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-N-formylkynurenine (CHEBI:2065) has functional parent N-formylkynurenine (CHEBI:18377) |
| 5-hydroxy-N-formylkynurenine (CHEBI:2065) has functional parent 5-hydroxykynurenine (CHEBI:2076) |
| 5-hydroxy-N-formylkynurenine (CHEBI:2065) has role human metabolite (CHEBI:77746) |
| 5-hydroxy-N-formylkynurenine (CHEBI:2065) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| 5-hydroxy-N-formyl-L-kynurenine (CHEBI:36407) is a 5-hydroxy-N-formylkynurenine (CHEBI:2065) |
| IUPAC Name |
|---|
| 2-amino-4-(2-formamido-5-hydroxyphenyl)-4-oxobutanoic acid |
| Synonym | Source |
|---|---|
| 5-Hydroxy-N-formylkynurenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05648 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5058149 | Reaxys |