EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:206442 - Chlamyphilone
| Formula | C12H12O4 |
| Net Charge | 0 |
| Average Mass | 220.224 |
| Monoisotopic Mass | 220.07356 |
| SMILES | CC1=C(C)C2=CC(=O)[C@](C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C12H12O4/c1-6-7(2)16-5-9-8(6)4-10(13)12(3,15)11(9)14/h4-5,15H,1-3H3/t12-/m0/s1 |
| InChIKey | QPVXXCCSELVKKM-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia chlamydosporia (ncbitaxon:280754) | - | PubMed (30791467) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlamyphilone (CHEBI:206442) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S)-7-hydroxy-3,4,7-trimethylisochromene-6,8-dione |