EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | CC1=CC2=C(CO1)C(=O)[C@](C)(O)[C@H](O)C2 |
| InChI | InChI=1S/C11H14O4/c1-6-3-7-4-9(12)11(2,14)10(13)8(7)5-15-6/h3,9,12,14H,4-5H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | VHXYBRLZAHZUHQ-MWLCHTKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium (ncbitaxon:5498) | - | PubMed (27240037) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bicyclic diol (CHEBI:205717) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (6R,7R)-6,7-dihydroxy-3,7-dimethyl-5,6-dihydro-1H-isochromen-8-one |
| Manual Xrefs | Databases |
|---|---|
| 24207393 | ChemSpider |