EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC1(C)C[C@H]2[C@H](O)c3coc(C(=O)O)c3[C@@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C15H20O5/c1-14(2)4-7-9(5-14)15(3,19)10-8(11(7)16)6-20-12(10)13(17)18/h6-7,9,11,16,19H,4-5H2,1-3H3,(H,17,18)/t7-,9+,11+,15+/m1/s1 |
| InChIKey | CKYFQWVHKHQCLS-PMCHEESUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clavicorona (ncbitaxon:48020) | - | DOI (10.1016/s0040-4020(03)00738-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epitsugicoline H (CHEBI:205063) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| (4S,4aR,7aS,8S)-4,8-dihydroxy-6,6,8-trimethyl-4a,5,7,7a-tetrahydro-4H-cyclopenta[][2]benzouran-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9996660 | ChemSpider |