EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:20506 - 5,6,7,8-tetrahydrofolic acid
| Formula | C19H23N7O6 |
| Net Charge | 0 |
| Average Mass | 445.436 |
| Monoisotopic Mass | 445.17098 |
| SMILES | Nc1nc2c(c(=O)n1)NC(CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t11?,12-/m0/s1 |
| InChIKey | MSTNYGQPCMXVAQ-KIYNQFGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) is a tetrahydrofolic acid (CHEBI:26907) |
| 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) is conjugate acid of 5,6,7,8-tetrahydrofolate(2−) (CHEBI:68437) |
| Incoming Relation(s) |
| 5-methyltetrahydrofolic acid (CHEBI:15641) has functional parent 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) |
| (6S)-5,6,7,8-tetrahydrofolic acid (CHEBI:15635) is a 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) |
| 5,6,7,8-tetrahydrofolate(2−) (CHEBI:68437) is conjugate base of 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) |
| IUPAC Name |
|---|
| N-[4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl]-L-glutamic acid |
| Synonyms | Source |
|---|---|
| THF | ChEBI |
| tetrahydrofolate | ChEBI |
| tetrahydrofolic acid | ChemIDplus |
| 5,6,7,8-tetrahydrofolic acid | ChemIDplus |
| (6S)-Tetrahydrofolate | KEGG COMPOUND |
| Tetrahydrofolic acid | KEGG COMPOUND |