EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15641 - 5-methyltetrahydrofolic acid
| Formula | C20H25N7O6 |
| Net Charge | 0 |
| Average Mass | 459.463 |
| Monoisotopic Mass | 459.18663 |
| SMILES | CN1c2c(nc(N)nc2=O)NCC1CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H25N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t12?,13-/m0/s1 |
| InChIKey | ZNOVTXRBGFNYRX-ABLWVSNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| cerebrospinal fluid (UBERON:0001359) | PubMed (9870205) | ||
| blood (UBERON:0000178) | PubMed (18160726) | ||
| cerebrospinal fluid (UBERON:0001359) | MetaboLights (MTBLS290) | From MetaboLights | |
| blood (UBERON:0000178) | MetaboLights (MTBLS290) | From MetaboLights | |
| Rattus norvegicus (ncbitaxon:10116) | Esophagus (BTO:0000959) | MetaboLights (MTBLS3014) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyltetrahydrofolic acid (CHEBI:15641) has functional parent 5,6,7,8-tetrahydrofolic acid (CHEBI:20506) |
| 5-methyltetrahydrofolic acid (CHEBI:15641) has role human metabolite (CHEBI:77746) |
| 5-methyltetrahydrofolic acid (CHEBI:15641) is a tetrahydrofolic acid (CHEBI:26907) |
| 5-methyltetrahydrofolic acid (CHEBI:15641) is conjugate acid of 5-methyltetrahydrofolate(2−) (CHEBI:189667) |
| Incoming Relation(s) |
| 5-methyltetrahydrofolyl polyglutamate macromolecule (CHEBI:63907) has functional parent 5-methyltetrahydrofolic acid (CHEBI:15641) |
| (6S)-5-methyltetrahydrofolic acid (CHEBI:136009) is a 5-methyltetrahydrofolic acid (CHEBI:15641) |
| 5-methyltetrahydrofolate(2−) (CHEBI:189667) is conjugate base of 5-methyltetrahydrofolic acid (CHEBI:15641) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| 5-methyltetrahydrofolate | KEGG COMPOUND |
| N-(5-methyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid | ChEBI |
| 5-methyl-5,6,7,8-tetrahydrofolate | HMDB |
| 5-methyl-5,6,7,8-tetrahydropteroyl-L-glutamic acid | ChEBI |
| N5-methyl-tetrahydrofolic acid | HMDB |
| N-methyltetrahydrofolic acid | DrugBank |
| Citations |
|---|