EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O5 |
| Net Charge | 0 |
| Average Mass | 330.380 |
| Monoisotopic Mass | 330.14672 |
| SMILES | CCC(C)C=C(C)C=CC1=CC2=C(O)C(=O)C(C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C19H22O5/c1-5-11(2)8-12(3)6-7-13-9-14-15(10-24-13)17(21)19(4,23)18(22)16(14)20/h6-11,20,23H,5H2,1-4H3 |
| InChIKey | LNWIOAGOUVWVSQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (24972351) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,5-dimethylhepta-1,3-dienyl)-5,7-dihydroxy-7-methylisochromene-6,8-dione (CHEBI:204860) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| 3-(3,5-dimethylhepta-1,3-dienyl)-5,7-dihydroxy-7-methylisochromene-6,8-dione |