EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO3 |
| Net Charge | 0 |
| Average Mass | 315.498 |
| Monoisotopic Mass | 315.27734 |
| SMILES | CCCCCCCCC/C=C/CCC[C@@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h10-11,16-18,20-22H,2-9,12-15,19H2,1H3/b11-10+/t16-,17+,18-/m0/s1 |
| InChIKey | CQKNELOTFUSOTP-HMTIOLNVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-8-sphingenine (CHEBI:20386) has functional parent sphing-8-enine (CHEBI:36478) |
| 4-hydroxy-8-sphingenine (CHEBI:20386) is a sphingoid (CHEBI:35785) |
| 4-hydroxy-8-sphingenine (CHEBI:20386) is conjugate base of 4-hydroxysphing-8-enine(1+) (CHEBI:83175) |
| Incoming Relation(s) |
| inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine (CHEBI:139528) has functional parent 4-hydroxy-8-sphingenine (CHEBI:20386) |
| 4-hydroxysphing-8-enine(1+) (CHEBI:83175) is conjugate acid of 4-hydroxy-8-sphingenine (CHEBI:20386) |
| IUPAC Name |
|---|
| (2S,3S,4R,8E)-2-aminooctadec-8-ene-1,3,4-triol |
| Synonyms | Source |
|---|---|
| 4R-hydroxysphing-8E-enine | LIPID MAPS |
| 8,9-didehydrophytosphingosine | ChEBI |
| Dehydrophytosphingosine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMSP01030002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8443209 | Reaxys |
| Citations |
|---|