EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47NO12PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 584.615 |
| Monoisotopic Mass (excl. R groups) | 584.28359 |
| SMILES | *C(=O)N[C@@H](COP(=O)(O)O[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CCC/C=C/CCCCCCCCC |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine (CHEBI:139528) has functional parent 4-hydroxy-8-sphingenine (CHEBI:20386) |
| inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine (CHEBI:139528) is a inositol phosphophytoceramide (CHEBI:64994) |
| inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine (CHEBI:139528) is conjugate acid of inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine(1−) (CHEBI:139054) |
| Incoming Relation(s) |
| inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine(1−) (CHEBI:139054) is conjugate base of inositol-1-phospho-N-acyl-(8E)-phytosphing-8-enine (CHEBI:139528) |
| Synonyms | Source |
|---|---|
| N-acyl-(E)-phytosphing-8-enine-1-phospho-(1D-myo-inositol) | ChEBI |
| inositol-1-phospho-N-acyl-(4R,8E)-4-hydroxysphing-8-enine | ChEBI |