EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O8 |
| Net Charge | 0 |
| Average Mass | 412.394 |
| Monoisotopic Mass | 412.11582 |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@](C)(OC(=O)c3c(C)cc(O)c(O)c3OC)C(=O)C2=CO1 |
| InChI | InChI=1S/C22H20O8/c1-5-6-13-8-12-9-16(24)22(3,20(26)14(12)10-29-13)30-21(27)17-11(2)7-15(23)18(25)19(17)28-4/h5-10,23,25H,1-4H3/b6-5+/t22-/m0/s1 |
| InChIKey | VKQIAFMFEISHPG-BDNZGDGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (16317828) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-hydroxy-3'-methoxy-(S)-mitorubrin (CHEBI:202714) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7S)-7-methyl-6,8-dioxo-3-[(E)-prop-1-enyl]isochromen-7-yl] 3,4-dihydroxy-2-methoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 34559250 | ChemSpider |