EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O6 |
| Net Charge | 0 |
| Average Mass | 470.606 |
| Monoisotopic Mass | 470.26684 |
| SMILES | CCCCCCCCC/C=C/C=C(\C)C(=O)O[C@@]1(C)C(=O)C=C2C=C(CC(C)O)OC=C2C1=O |
| InChI | InChI=1S/C28H38O6/c1-5-6-7-8-9-10-11-12-13-14-15-20(2)27(32)34-28(4)25(30)18-22-17-23(16-21(3)29)33-19-24(22)26(28)31/h13-15,17-19,21,29H,5-12,16H2,1-4H3/b14-13+,20-15+/t21?,28-/m0/s1 |
| InChIKey | TYZWBYXLNZVGMK-CTMKRBNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon rubiginosum (ncbitaxon:110542) | - | PubMed (15270570) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rubiginosin C (CHEBI:202357) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7S)-3-(2-hydroxypropyl)-7-methyl-6,8-dioxoisochromen-7-yl] (2E,4E)-2-methyltetradeca-2,4-dienoate |
| Manual Xrefs | Databases |
|---|---|
| 9617648 | ChemSpider |