EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | QGXBDMJGAMFCBF-HLUDHZFRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| urine (BTO:0001419) | Article (David F. Putnam Composition and Concentrative Properties of Human Urine. NASA Contractor Report. July 1971) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (16585475) | ||
| blood (UBERON:0000178) | PubMed (17716701) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsterone (CHEBI:16032) has parent hydride 5α-androstane (CHEBI:28859) |
| androsterone (CHEBI:16032) has role androgen (CHEBI:50113) |
| androsterone (CHEBI:16032) has role anticonvulsant (CHEBI:35623) |
| androsterone (CHEBI:16032) has role human blood serum metabolite (CHEBI:85234) |
| androsterone (CHEBI:16032) has role human metabolite (CHEBI:77746) |
| androsterone (CHEBI:16032) has role human urinary metabolite (CHEBI:84087) |
| androsterone (CHEBI:16032) has role mouse metabolite (CHEBI:75771) |
| androsterone (CHEBI:16032) has role pheromone (CHEBI:26013) |
| androsterone (CHEBI:16032) is a 17-oxo steroid (CHEBI:19168) |
| androsterone (CHEBI:16032) is a 3α-hydroxy steroid (CHEBI:36835) |
| androsterone (CHEBI:16032) is a androstanoid (CHEBI:50402) |
| androsterone (CHEBI:16032) is a C19-steroid (CHEBI:131621) |
| Incoming Relation(s) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent androsterone (CHEBI:16032) |
| androsterone sulfate (CHEBI:83037) has functional parent androsterone (CHEBI:16032) |
| IUPAC Name |
|---|
| 3α-hydroxy-5α-androstan-17-one |
| Synonyms | Source |
|---|---|
| 3alpha-Hydroxy-5alpha-androstan-17-one | KEGG COMPOUND |
| 3-epihydroxyetioallocholan-17-one | ChemIDplus |
| (3α,5α)-3-hydroxyandrostan-17-one | NIST Chemistry WebBook |
| 3α-hydroxyetioallocholan-17-one | NIST Chemistry WebBook |
| 5α-androstane-3α-ol-17-one | NIST Chemistry WebBook |
| 5α-androsterone | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| androsterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5668 | ChemSpider |
| Androsterone | Wikipedia |
| ANDROSTERONE | MetaCyc |
| AOI | PDBeChem |
| C00523 | KEGG COMPOUND |
| FDB021881 | FooDB |
| HMDB0000031 | HMDB |
| LMST02020001 | LIPID MAPS |
| Citations |
|---|