EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-9-14-15(22)10-16(23)17-18(24)19(25)20(27-21(14)17)12-5-7-13(26-3)8-6-12/h4-8,10,22-23,25H,9H2,1-3H3 |
| InChIKey | TUUXBSASAQJECY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icaritin (CHEBI:201674) has role antineoplastic agent (CHEBI:35610) |
| icaritin (CHEBI:201674) is a flavones (CHEBI:24043) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| Synonyms | Source |
|---|---|
| Icaritin | ChEMBL |
| SGN-162 | ChEMBL |
| SGN162 | ChEMBL |
| Citations |
|---|