EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O5 |
| Net Charge | 0 |
| Average Mass | 184.147 |
| Monoisotopic Mass | 184.03717 |
| SMILES | CC(=O)OCc1cc(C(=O)O)co1 |
| InChI | InChI=1S/C8H8O5/c1-5(9)12-4-7-2-6(3-13-7)8(10)11/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | YVKUULHZJZWUTP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (25942282) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-acetoxymethylfuran-3-carboxylic acid (CHEBI:201310) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(acetyloxymethyl)uran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434691 | ChemSpider |