EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O3 |
| Net Charge | 0 |
| Average Mass | 260.333 |
| Monoisotopic Mass | 260.14124 |
| SMILES | CC(C)=CCc1c(O)c(C)c(O)c2c1C=C(C)OC2 |
| InChI | InChI=1S/C16H20O3/c1-9(2)5-6-12-13-7-10(3)19-8-14(13)16(18)11(4)15(12)17/h5,7,17-18H,6,8H2,1-4H3 |
| InChIKey | GLAUCFARDHBBTA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotomopilus indicus (ncbitaxon:1934381) | - | PubMed (23767797) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaetophenol B (CHEBI:200386) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| 3,7-dimethyl-5-(3-methylbut-2-enyl)-1H-isochromene-6,8-diol |
| Manual Xrefs | Databases |
|---|---|
| 78434661 | ChemSpider |