EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4O6 |
| Net Charge | -2 |
| Average Mass | 184.103 |
| Monoisotopic Mass | 184.00189 |
| SMILES | O=C([O-])/C=C/C(=O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/p-2/b2-1+ |
| InChIKey | AZCFLHZUFANAOR-OWOJBTEDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fumarylpyruvate(2−) (CHEBI:16854) is a 4,6-dioxohept-2-enedioate (CHEBI:47941) |
| 3-fumarylpyruvate(2−) (CHEBI:16854) is conjugate base of 3-fumarylpyruvic acid (CHEBI:1506) |
| Incoming Relation(s) |
| 3-fumarylpyruvic acid (CHEBI:1506) is conjugate acid of 3-fumarylpyruvate(2−) (CHEBI:16854) |
| IUPAC Name |
|---|
| (2E)-4,6-dioxohept-2-enedioate |
| UniProt Name | Source |
|---|---|
| 3-fumarylpyruvate | UniProt |