EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | C[C@H]1CCC[C@@]2(CC3=C(CO2)C(=O)[C@](C)(O)[C@@H](O)C3)O1 |
| InChI | InChI=1S/C15H22O5/c1-9-4-3-5-15(20-9)7-10-6-12(16)14(2,18)13(17)11(10)8-19-15/h9,12,16,18H,3-8H2,1-2H3/t9-,12-,14+,15-/m0/s1 |
| InChIKey | BKSQJYOLLWNPIP-GGZSPTBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis (ncbitaxon:37840) | - | PubMed (18288805) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestafolide A (CHEBI:200047) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (3S,6S,6'S,7R)-6,7-dihydroxy-6',7-dimethylspiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-8-one |
| Manual Xrefs | Databases |
|---|---|
| 23340872 | ChemSpider |