EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC(CN)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | QCHPKSFMDHPSNR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminoisobutyric acid (CHEBI:27389) has functional parent isobutyric acid (CHEBI:16135) |
| 3-aminoisobutyric acid (CHEBI:27389) has role metabolite (CHEBI:25212) |
| 3-aminoisobutyric acid (CHEBI:27389) is a β-amino acid (CHEBI:33706) |
| 3-aminoisobutyric acid (CHEBI:27389) is conjugate acid of 3-aminoisobutyrate (CHEBI:49096) |
| 3-aminoisobutyric acid (CHEBI:27389) is tautomer of 3-aminoisobutanoic acid zwitterion (CHEBI:142590) |
| Incoming Relation(s) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is a 3-aminoisobutyric acid (CHEBI:27389) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is a 3-aminoisobutyric acid (CHEBI:27389) |
| 3-aminoisobutyrate (CHEBI:49096) is conjugate base of 3-aminoisobutyric acid (CHEBI:27389) |
| 3-aminoisobutanoic acid zwitterion (CHEBI:142590) is tautomer of 3-aminoisobutyric acid (CHEBI:27389) |
| IUPAC Name |
|---|
| 3-amino-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| 2-(aminomethyl)propionic acid | ChemIDplus |
| 2-Methyl-beta-alanine | HMDB |
| 3-Amino-2-methylpropanoate | KEGG COMPOUND |
| 3-Aminoisobutanoate | KEGG COMPOUND |
| 3-Aminoisobutanoic acid | HMDB |
| 3-aminoisobutyric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3-AMINO-ISOBUTYRATE | MetaCyc |
| 3-Aminoisobutyric_acid | Wikipedia |
| C05145 | KEGG COMPOUND |
| HMDB0003911 | HMDB |
| LMFA01100054 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1520758 | Gmelin |
| Reaxys:1720958 | Reaxys |
| Beilstein:1720958 | Beilstein |
| Beilstein:1745458 | Beilstein |
| CAS:10569-72-9 | ChemIDplus |
| CAS:10569-72-9 | NIST Chemistry WebBook |
| CAS:144-90-1 | ChemIDplus |
| CAS:144-90-1 | KEGG COMPOUND |
| Citations |
|---|