EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CC1=CC2=C(C)C(=O)[C@@](C)(O)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C12H16O4/c1-6-4-8-7(2)10(13)12(3,15)11(14)9(8)5-16-6/h4,9,11,14-15H,5H2,1-3H3/t9-,11+,12-/m1/s1 |
| InChIKey | CGRHRRPYPFDVGZ-ADEWGFFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypella (ncbitaxon:140192) | - | PubMed (23061665) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S,8S,8aS)-7,8-dihydroxy-3,5,7-trimethyl-8,8a-dihydro-1H-isochromen-6(7H)-one (CHEBI:199499) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S,8S,8aS)-7,8-dihydroxy-3,5,7-trimethyl-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 29784889 | ChemSpider |