EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | O=C([O-])C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1 |
| InChIKey | JVGVDSSUAVXRDY-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) has functional parent lactate (CHEBI:24996) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) has role human metabolite (CHEBI:77746) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) is a 2-hydroxy carboxylate (CHEBI:58896) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) is conjugate base of 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) |
| Incoming Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) is a 3-(4-hydroxyphenyl)lactate (CHEBI:36659) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) is conjugate acid of 3-(4-hydroxyphenyl)lactate (CHEBI:36659) |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-3-(4-hydroxyphenyl)propanoate | KEGG COMPOUND |
| 3-(4-Hydroxyphenyl)lactate | KEGG COMPOUND |
| 4-Hydroxyphenyllactate | KEGG COMPOUND |
| p-Hydroxyphenyllactate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-3-(4-hydroxyphenyl)propanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-HYDROXYPHENYLLACTATE | MetaCyc |
| C03672 | KEGG COMPOUND |