EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | O=C([O-])[C@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1/t8-/m1/s1 |
| InChIKey | JVGVDSSUAVXRDY-MRVPVSSYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) is a (2R)-2-hydroxy monocarboxylic acid anion (CHEBI:58314) |
| (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) is a 3-(4-hydroxyphenyl)lactate (CHEBI:36659) |
| (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) is conjugate base of (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) |
| Incoming Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) is conjugate acid of (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate |
| Synonym | Source |
|---|---|
| (R)-3-(4-Hydroxyphenyl)lactate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03964 | KEGG COMPOUND |