EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O8 |
| Net Charge | 0 |
| Average Mass | 428.437 |
| Monoisotopic Mass | 428.14712 |
| SMILES | CC1=CC2=C(CC3=C4C=C(C)OC=C4[C@H](O)[C@@](C)(O)C3=O)C(=O)[C@](C)(O)[C@@H](O)C2=CO1 |
| InChI | InChI=1S/C23H24O8/c1-10-5-12-14(18(24)22(3,28)20(26)16(12)8-30-10)7-15-13-6-11(2)31-9-17(13)21(27)23(4,29)19(15)25/h5-6,8-9,20-21,26-29H,7H2,1-4H3/t20-,21-,22-,23-/m0/s1 |
| InChIKey | NUEAJZBUQLVGMV-MLCQCVOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoleptodiscus indicus (ncbitaxon:745397) | - | PubMed (24387625) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mycoleptone A (CHEBI:197832) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8S)-5-[[(7R,8S)-7,8-dihydroxy-3,7-dimethyl-6-oxo-8H-isochromen-5-yl]methyl]-7,8-dihydroxy-3,7-dimethyl-8H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 31128881 | ChemSpider |